C14H22N2OS — CID 81115076
2-(4-ethyl-1,3-thiazol-2-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81115076) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-(4-ethyl-1,3-thiazol-2-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-(4-ethyl-1,3-thiazol-2-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81115076 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-(4-ethyl-1,3-thiazol-2-yl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | CCc1csc(N2CCC3(O)CCCCC3C2)n1 |
| InChI | InChI=1S/C14H22N2OS/c1-2-12-10-18-13(15-12)16-8-7-14(17)6-4-3-5-11(14)9-16/h10-11,17H,2-9H2,1H3 |
| InChIKey | MSOAYJTUEHEHEA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |