C9H15N5O3 — CID 19827670
N,N-dimethyl-4-morpholin-4-yl-5-nitro-1H-imidazol-2-amine (PubChem CID 19827670) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is N,N-dimethyl-4-morpholin-4-yl-5-nitro-1H-imidazol-2-amine.
| Compound Name | N,N-dimethyl-4-morpholin-4-yl-5-nitro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 19827670 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N,N-dimethyl-4-morpholin-4-yl-5-nitro-1H-imidazol-2-amine |
| SMILES | CN(C)c1nc(N2CCOCC2)c([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C9H15N5O3/c1-12(2)9-10-7(8(11-9)14(15)16)13-3-5-17-6-4-13/h3-6H2,1-2H3,(H,10,11) |
| InChIKey | XGUAJIPIJOJFBA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|