C10H17N5O — CID 121204937
4-N,4-N-dimethyl-2-morpholin-4-ylpyrimidine-4,5-diamine (PubChem CID 121204937) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-2-morpholin-4-ylpyrimidine-4,5-diamine.
| Compound Name | 4-N,4-N-dimethyl-2-morpholin-4-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 121204937 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 4-N,4-N-dimethyl-2-morpholin-4-ylpyrimidine-4,5-diamine |
| SMILES | CN(C)c1nc(N2CCOCC2)ncc1N |
| InChI | InChI=1S/C10H17N5O/c1-14(2)9-8(11)7-12-10(13-9)15-3-5-16-6-4-15/h7H,3-6,11H2,1-2H3 |
| InChIKey | KHXKVEJYXSFANN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |