C13H21N5O2 — CID 121137362
N-[4-(dimethylamino)-2-morpholin-4-ylpyrimidin-5-yl]propanamide (PubChem CID 121137362) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-morpholin-4-ylpyrimidin-5-yl]propanamide.
| Compound Name | N-[4-(dimethylamino)-2-morpholin-4-ylpyrimidin-5-yl]propanamide |
|---|---|
| PubChem CID | 121137362 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-[4-(dimethylamino)-2-morpholin-4-ylpyrimidin-5-yl]propanamide |
| SMILES | CCC(=O)Nc1cnc(N2CCOCC2)nc1N(C)C |
| InChI | InChI=1S/C13H21N5O2/c1-4-11(19)15-10-9-14-13(16-12(10)17(2)3)18-5-7-20-8-6-18/h9H,4-8H2,1-3H3,(H,15,19) |
| InChIKey | BLLVFPLWTQCFGH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |