C19H25N5O4 — CID 122320438
N-[4-(dimethylamino)-2-morpholin-4-ylpyrimidin-5-yl]-2-(2-methoxyphenoxy)acetamide (PubChem CID 122320438) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-morpholin-4-ylpyrimidin-5-yl]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-[4-(dimethylamino)-2-morpholin-4-ylpyrimidin-5-yl]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 122320438 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-[4-(dimethylamino)-2-morpholin-4-ylpyrimidin-5-yl]-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)Nc1cnc(N2CCOCC2)nc1N(C)C |
| InChI | InChI=1S/C19H25N5O4/c1-23(2)18-14(12-20-19(22-18)24-8-10-27-11-9-24)21-17(25)13-28-16-7-5-4-6-15(16)26-3/h4-7,12H,8-11,13H2,1-3H3,(H,21,25) |
| InChIKey | AWIDXDNPCJVVCM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |