C18H22ClN5O2 — CID 91969330
2-(4-chlorophenoxy)-N-[4-(dimethylamino)-2-pyrrolidin-1-ylpyrimidin-5-yl]acetamide (PubChem CID 91969330) has the molecular formula C18H22ClN5O2 and a molecular weight of 375.86 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[4-(dimethylamino)-2-pyrrolidin-1-ylpyrimidin-5-yl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[4-(dimethylamino)-2-pyrrolidin-1-ylpyrimidin-5-yl]acetamide |
|---|---|
| PubChem CID | 91969330 |
| Molecular Formula | C18H22ClN5O2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[4-(dimethylamino)-2-pyrrolidin-1-ylpyrimidin-5-yl]acetamide |
| SMILES | CN(C)c1nc(N2CCCC2)ncc1NC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClN5O2/c1-23(2)17-15(11-20-18(22-17)24-9-3-4-10-24)21-16(25)12-26-14-7-5-13(19)6-8-14/h5-8,11H,3-4,9-10,12H2,1-2H3,(H,21,25) |
| InChIKey | TZSOSBINQUZDGG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |