C6H9N3O2S — CID 89274261
5-morpholin-4-yl-1,2,4-thiadiazol-3-one (PubChem CID 89274261) has the molecular formula C6H9N3O2S and a molecular weight of 187.22 g/mol. Its IUPAC name is 5-morpholin-4-yl-1,2,4-thiadiazol-3-one.
| Compound Name | 5-morpholin-4-yl-1,2,4-thiadiazol-3-one |
|---|---|
| PubChem CID | 89274261 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 5-morpholin-4-yl-1,2,4-thiadiazol-3-one |
| SMILES | O=c1nc(N2CCOCC2)s[nH]1 |
| InChI | InChI=1S/C6H9N3O2S/c10-5-7-6(12-8-5)9-1-3-11-4-2-9/h1-4H2,(H,8,10) |
| InChIKey | JBLCEHRWAKVYHC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |