C7H12N4O2 — CID 19390520
2-methyl-3-morpholin-4-yl-1H-1,2,4-triazol-5-one (PubChem CID 19390520) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-methyl-3-morpholin-4-yl-1H-1,2,4-triazol-5-one.
| Compound Name | 2-methyl-3-morpholin-4-yl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 19390520 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-methyl-3-morpholin-4-yl-1H-1,2,4-triazol-5-one |
| SMILES | Cn1[nH]c(=O)nc1N1CCOCC1 |
| InChI | InChI=1S/C7H12N4O2/c1-10-7(8-6(12)9-10)11-2-4-13-5-3-11/h2-5H2,1H3,(H,9,12) |
| InChIKey | BKOCLGCLXMMFBP-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |