About 4-(2-methyl-1,5-dihydro-1,2,4-triazol-5-yl)morpholine
4-(2-methyl-1,5-dihydro-1,2,4-triazol-5-yl)morpholine (PubChem CID 154523304) has the molecular formula C7H14N4O
and a molecular weight of 170.22 g/mol. Its IUPAC name is 4-(2-methyl-1,5-dihydro-1,2,4-triazol-5-yl)morpholine.
Analyze 4-(2-methyl-1,5-dihydro-1,2,4-triazol-5-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-1,5-dihydro-1,2,4-triazol-5-yl)morpholine?
The IUPAC name of 4-(2-methyl-1,5-dihydro-1,2,4-triazol-5-yl)morpholine (CID 154523304) is 4-(2-methyl-1,5-dihydro-1,2,4-triazol-5-yl)morpholine.
What is the SMILES notation for 4-(2-methyl-1,5-dihydro-1,2,4-triazol-5-yl)morpholine?
The canonical SMILES for 4-(2-methyl-1,5-dihydro-1,2,4-triazol-5-yl)morpholine is CN1C=NC(N2CCOCC2)N1.
What is the InChIKey of 4-(2-methyl-1,5-dihydro-1,2,4-triazol-5-yl)morpholine?
The InChIKey is RPSKNFUTJIQLBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O/c1-10-6-8-7(9-10)11-2-4-12-5-3-11/h6-7,9H,2-5H2,1H3.
What are the key properties of 4-(2-methyl-1,5-dihydro-1,2,4-triazol-5-yl)morpholine?
4-(2-methyl-1,5-dihydro-1,2,4-triazol-5-yl)morpholine has a molecular weight of 170.22 g/mol, XLogP of -0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,5-dihydro-1,2,4-triazol-5-yl)morpholine is sourced from PubChem (CID 154523304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).