C7H14N4O — CID 152660691
4-(1,3-dihydro-1,2,4-triazol-2-ylmethyl)morpholine (PubChem CID 152660691) has the molecular formula C7H14N4O and a molecular weight of 170.22 g/mol. Its IUPAC name is 4-(1,3-dihydro-1,2,4-triazol-2-ylmethyl)morpholine.
| Compound Name | 4-(1,3-dihydro-1,2,4-triazol-2-ylmethyl)morpholine |
|---|---|
| PubChem CID | 152660691 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | 4-(1,3-dihydro-1,2,4-triazol-2-ylmethyl)morpholine |
| SMILES | C1=NCN(CN2CCOCC2)N1 |
| InChI | InChI=1S/C7H14N4O/c1-3-12-4-2-10(1)7-11-6-8-5-9-11/h5H,1-4,6-7H2,(H,8,9) |
| InChIKey | ZJMJUMMSWJAALB-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |