C7H12N4OS — CID 86126780
2-(morpholin-4-ylmethyl)-1H-1,2,4-triazole-3-thione (PubChem CID 86126780) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is 2-(morpholin-4-ylmethyl)-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-(morpholin-4-ylmethyl)-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 86126780 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-(morpholin-4-ylmethyl)-1H-1,2,4-triazole-3-thione |
| SMILES | S=c1nc[nH]n1CN1CCOCC1 |
| InChI | InChI=1S/C7H12N4OS/c13-7-8-5-9-11(7)6-10-1-3-12-4-2-10/h5H,1-4,6H2,(H,8,9,13) |
| InChIKey | LHKGNHIJHPUYSB-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 46.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|