C10H16N6O3 — CID 79676627
4-(4,6-dimethoxy-1,3,5-triazin-2-yl)morpholine-2-carboximidamide (PubChem CID 79676627) has the molecular formula C10H16N6O3 and a molecular weight of 268.28 g/mol. Its IUPAC name is 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)morpholine-2-carboximidamide.
| Compound Name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)morpholine-2-carboximidamide |
|---|---|
| PubChem CID | 79676627 |
| Molecular Formula | C10H16N6O3 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)morpholine-2-carboximidamide |
| SMILES | [H]/N=C(\N)C1CN(c2nc(OC)nc(OC)n2)CCO1 |
| InChI | InChI=1S/C10H16N6O3/c1-17-9-13-8(14-10(15-9)18-2)16-3-4-19-6(5-16)7(11)12/h6H,3-5H2,1-2H3,(H3,11,12) |
| InChIKey | GBWLYRBAVXDGME-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|