C12H16N6O — CID 103385326
4-(1-methylimidazo[4,5-c]pyridin-4-yl)morpholine-2-carboximidamide (PubChem CID 103385326) has the molecular formula C12H16N6O and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-(1-methylimidazo[4,5-c]pyridin-4-yl)morpholine-2-carboximidamide.
| Compound Name | 4-(1-methylimidazo[4,5-c]pyridin-4-yl)morpholine-2-carboximidamide |
|---|---|
| PubChem CID | 103385326 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-(1-methylimidazo[4,5-c]pyridin-4-yl)morpholine-2-carboximidamide |
| SMILES | [H]/N=C(\N)C1CN(c2nccc3c2ncn3C)CCO1 |
| InChI | InChI=1S/C12H16N6O/c1-17-7-16-10-8(17)2-3-15-12(10)18-4-5-19-9(6-18)11(13)14/h2-3,7,9H,4-6H2,1H3,(H3,13,14) |
| InChIKey | GTLQOXKYAPLRLO-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 93.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|