C11H17N5O — CID 79676340
4-(4,6-dimethylpyrimidin-2-yl)morpholine-2-carboximidamide (PubChem CID 79676340) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-(4,6-dimethylpyrimidin-2-yl)morpholine-2-carboximidamide.
| Compound Name | 4-(4,6-dimethylpyrimidin-2-yl)morpholine-2-carboximidamide |
|---|---|
| PubChem CID | 79676340 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 4-(4,6-dimethylpyrimidin-2-yl)morpholine-2-carboximidamide |
| SMILES | [H]/N=C(\N)C1CN(c2nc(C)cc(C)n2)CCO1 |
| InChI | InChI=1S/C11H17N5O/c1-7-5-8(2)15-11(14-7)16-3-4-17-9(6-16)10(12)13/h5,9H,3-4,6H2,1-2H3,(H3,12,13) |
| InChIKey | ICVPSKFVLHMKCD-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|