About 1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol
1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol (PubChem CID 112676295) has the molecular formula C10H12F2N2O
and a molecular weight of 214.21 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol |
| PubChem CID | 112676295 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol |
| SMILES | OC1CCN(c2ncc(F)cc2F)CC1 |
| InChI | InChI=1S/C10H12F2N2O/c11-7-5-9(12)10(13-6-7)14-3-1-8(15)2-4-14/h5-6,8,15H,1-4H2 |
| InChIKey | AHYRIOJJZPHAIS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol?
The IUPAC name of 1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol (CID 112676295) is 1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol.
What is the SMILES notation for 1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol?
The canonical SMILES for 1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol is OC1CCN(c2ncc(F)cc2F)CC1.
What is the InChIKey of 1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol?
The InChIKey is AHYRIOJJZPHAIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N2O/c11-7-5-9(12)10(13-6-7)14-3-1-8(15)2-4-14/h5-6,8,15H,1-4H2.
What are the key properties of 1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol?
1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol has a molecular weight of 214.21 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-difluoro-2-pyridinyl)piperidin-4-ol is sourced from PubChem (CID 112676295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).