C11H14F2N2O — CID 114799515
2-[1-(3,5-difluoro-2-pyridinyl)pyrrolidin-3-yl]ethanol (PubChem CID 114799515) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is 2-[1-(3,5-difluoro-2-pyridinyl)pyrrolidin-3-yl]ethanol.
| Compound Name | 2-[1-(3,5-difluoro-2-pyridinyl)pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 114799515 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-[1-(3,5-difluoro-2-pyridinyl)pyrrolidin-3-yl]ethanol |
| SMILES | OCCC1CCN(c2ncc(F)cc2F)C1 |
| InChI | InChI=1S/C11H14F2N2O/c12-9-5-10(13)11(14-6-9)15-3-1-8(7-15)2-4-16/h5-6,8,16H,1-4,7H2 |
| InChIKey | QKAUQHXLSCISMF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |