C10H15ClN4O — CID 114802870
2-[1-(2-amino-5-chloropyrimidin-4-yl)pyrrolidin-3-yl]ethanol (PubChem CID 114802870) has the molecular formula C10H15ClN4O and a molecular weight of 242.71 g/mol. Its IUPAC name is 2-[1-(2-amino-5-chloropyrimidin-4-yl)pyrrolidin-3-yl]ethanol.
| Compound Name | 2-[1-(2-amino-5-chloropyrimidin-4-yl)pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 114802870 |
| Molecular Formula | C10H15ClN4O |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-[1-(2-amino-5-chloropyrimidin-4-yl)pyrrolidin-3-yl]ethanol |
| SMILES | Nc1ncc(Cl)c(N2CCC(CCO)C2)n1 |
| InChI | InChI=1S/C10H15ClN4O/c11-8-5-13-10(12)14-9(8)15-3-1-7(6-15)2-4-16/h5,7,16H,1-4,6H2,(H2,12,13,14) |
| InChIKey | WJKKCGGAAKFHPW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |