C11H17ClN4O2 — CID 82693070
2-[1-(2-amino-5-chloropyrimidin-4-yl)piperidin-4-yl]oxyethanol (PubChem CID 82693070) has the molecular formula C11H17ClN4O2 and a molecular weight of 272.74 g/mol. Its IUPAC name is 2-[1-(2-amino-5-chloropyrimidin-4-yl)piperidin-4-yl]oxyethanol.
| Compound Name | 2-[1-(2-amino-5-chloropyrimidin-4-yl)piperidin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 82693070 |
| Molecular Formula | C11H17ClN4O2 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-[1-(2-amino-5-chloropyrimidin-4-yl)piperidin-4-yl]oxyethanol |
| SMILES | Nc1ncc(Cl)c(N2CCC(OCCO)CC2)n1 |
| InChI | InChI=1S/C11H17ClN4O2/c12-9-7-14-11(13)15-10(9)16-3-1-8(2-4-16)18-6-5-17/h7-8,17H,1-6H2,(H2,13,14,15) |
| InChIKey | WFOKPFFLRQPWJL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |