C12H18ClN5 — CID 80828314
5-chloro-4-(3-pyrrolidin-1-ylpyrrolidin-1-yl)pyrimidin-2-amine (PubChem CID 80828314) has the molecular formula C12H18ClN5 and a molecular weight of 267.76 g/mol. Its IUPAC name is 5-chloro-4-(3-pyrrolidin-1-ylpyrrolidin-1-yl)pyrimidin-2-amine.
| Compound Name | 5-chloro-4-(3-pyrrolidin-1-ylpyrrolidin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80828314 |
| Molecular Formula | C12H18ClN5 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 5-chloro-4-(3-pyrrolidin-1-ylpyrrolidin-1-yl)pyrimidin-2-amine |
| SMILES | Nc1ncc(Cl)c(N2CCC(N3CCCC3)C2)n1 |
| InChI | InChI=1S/C12H18ClN5/c13-10-7-15-12(14)16-11(10)18-6-3-9(8-18)17-4-1-2-5-17/h7,9H,1-6,8H2,(H2,14,15,16) |
| InChIKey | LDZVTTGQBAIFIQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |