C25H20F3N3O — CID 10410706
anthracen-9-yl-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone (PubChem CID 10410706) has the molecular formula C25H20F3N3O and a molecular weight of 435.45 g/mol. Its IUPAC name is anthracen-9-yl-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone.
| Compound Name | anthracen-9-yl-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 10410706 |
| Molecular Formula | C25H20F3N3O |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | anthracen-9-yl-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1c2ccccc2cc2ccccc12)N1CCN(c2cc(C(F)(F)F)ccn2)CC1 |
| InChI | InChI=1S/C25H20F3N3O/c26-25(27,28)19-9-10-29-22(16-19)30-11-13-31(14-12-30)24(32)23-20-7-3-1-5-17(20)15-18-6-2-4-8-21(18)23/h1-10,15-16H,11-14H2 |
| InChIKey | QWOXZLKAOVEPFT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|