C18H22F3N5O3 — CID 154919125
(1,5-dimethylpyrazol-4-yl)-[4-[4-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]methanone;formic acid (PubChem CID 154919125) has the molecular formula C18H22F3N5O3 and a molecular weight of 413.40 g/mol. Its IUPAC name is (1,5-dimethylpyrazol-4-yl)-[4-[4-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]methanone;formic acid.
| Compound Name | (1,5-dimethylpyrazol-4-yl)-[4-[4-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 154919125 |
| Molecular Formula | C18H22F3N5O3 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (1,5-dimethylpyrazol-4-yl)-[4-[4-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]methanone;formic acid |
| SMILES | Cc1c(C(=O)N2CCCN(c3cc(C(F)(F)F)ccn3)CC2)cnn1C.O=CO |
| InChI | InChI=1S/C17H20F3N5O.CH2O2/c1-12-14(11-22-23(12)2)16(26)25-7-3-6-24(8-9-25)15-10-13(4-5-21-15)17(18,19)20;2-1-3/h4-5,10-11H,3,6-9H2,1-2H3;1H,(H,2,3) |
| InChIKey | UPCOGLRMFDFMGZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|