C16H21F3N4O — CID 129171739
(3-aminocyclopentyl)-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone (PubChem CID 129171739) has the molecular formula C16H21F3N4O and a molecular weight of 342.37 g/mol. Its IUPAC name is (3-aminocyclopentyl)-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone.
| Compound Name | (3-aminocyclopentyl)-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 129171739 |
| Molecular Formula | C16H21F3N4O |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (3-aminocyclopentyl)-[4-[4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
| SMILES | NC1CCC(C(=O)N2CCN(c3cc(C(F)(F)F)ccn3)CC2)C1 |
| InChI | InChI=1S/C16H21F3N4O/c17-16(18,19)12-3-4-21-14(10-12)22-5-7-23(8-6-22)15(24)11-1-2-13(20)9-11/h3-4,10-11,13H,1-2,5-9,20H2 |
| InChIKey | IKNFYDNLYZNJSQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |