C21H20F3N5O — CID 10387136
1-(1-methylisoquinolin-5-yl)-3-[1-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]urea (PubChem CID 10387136) has the molecular formula C21H20F3N5O and a molecular weight of 415.42 g/mol. Its IUPAC name is 1-(1-methylisoquinolin-5-yl)-3-[1-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]urea.
| Compound Name | 1-(1-methylisoquinolin-5-yl)-3-[1-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 10387136 |
| Molecular Formula | C21H20F3N5O |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 1-(1-methylisoquinolin-5-yl)-3-[1-[4-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]urea |
| SMILES | Cc1nccc2c(NC(=O)NC3CCN(c4cc(C(F)(F)F)ccn4)C3)cccc12 |
| InChI | InChI=1S/C21H20F3N5O/c1-13-16-3-2-4-18(17(16)6-9-25-13)28-20(30)27-15-7-10-29(12-15)19-11-14(5-8-26-19)21(22,23)24/h2-6,8-9,11,15H,7,10,12H2,1H3,(H2,27,28,30) |
| InChIKey | TUMKLXJPRZQXBO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |