C21H21F3N6O — CID 10002770
1-(1-methylisoquinolin-5-yl)-3-[1-[2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]urea (PubChem CID 10002770) has the molecular formula C21H21F3N6O and a molecular weight of 430.43 g/mol. Its IUPAC name is 1-(1-methylisoquinolin-5-yl)-3-[1-[2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]urea.
| Compound Name | 1-(1-methylisoquinolin-5-yl)-3-[1-[2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 10002770 |
| Molecular Formula | C21H21F3N6O |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-(1-methylisoquinolin-5-yl)-3-[1-[2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]urea |
| SMILES | Cc1nccc2c(NC(=O)NC3CCN(c4ccnc(C(F)(F)F)n4)CC3)cccc12 |
| InChI | InChI=1S/C21H21F3N6O/c1-13-15-3-2-4-17(16(15)5-9-25-13)28-20(31)27-14-7-11-30(12-8-14)18-6-10-26-19(29-18)21(22,23)24/h2-6,9-10,14H,7-8,11-12H2,1H3,(H2,27,28,31) |
| InChIKey | ZFVBJHPDHWOXTM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |