C18H27F3N6O — CID 2810981
1-cyclohexyl-3-[2-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethyl]urea (PubChem CID 2810981) has the molecular formula C18H27F3N6O and a molecular weight of 400.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 2810981 |
| Molecular Formula | C18H27F3N6O |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1-cyclohexyl-3-[2-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethyl]urea |
| SMILES | O=C(NCCN1CCN(c2nccc(C(F)(F)F)n2)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C18H27F3N6O/c19-18(20,21)15-6-7-22-16(25-15)27-12-10-26(11-13-27)9-8-23-17(28)24-14-4-2-1-3-5-14/h6-7,14H,1-5,8-13H2,(H2,23,24,28) |
| InChIKey | JXCXJROXLFHFBV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |