C14H18F3N5O3 — CID 87799581
2-(ethylamino)-2-(2-oxoethyl)-4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid (PubChem CID 87799581) has the molecular formula C14H18F3N5O3 and a molecular weight of 361.32 g/mol. Its IUPAC name is 2-(ethylamino)-2-(2-oxoethyl)-4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid.
| Compound Name | 2-(ethylamino)-2-(2-oxoethyl)-4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87799581 |
| Molecular Formula | C14H18F3N5O3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 2-(ethylamino)-2-(2-oxoethyl)-4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid |
| SMILES | CCNC1(CC=O)CN(c2nccc(C(F)(F)F)n2)CCN1C(=O)O |
| InChI | InChI=1S/C14H18F3N5O3/c1-2-19-13(4-8-23)9-21(6-7-22(13)12(24)25)11-18-5-3-10(20-11)14(15,16)17/h3,5,8,19H,2,4,6-7,9H2,1H3,(H,24,25) |
| InChIKey | CTVQYQFPALGCMJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|