C13H17F3N4O2 — CID 164633560
[(9aR)-8-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol (PubChem CID 164633560) has the molecular formula C13H17F3N4O2 and a molecular weight of 318.30 g/mol. Its IUPAC name is [(9aR)-8-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol.
| Compound Name | [(9aR)-8-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol |
|---|---|
| PubChem CID | 164633560 |
| Molecular Formula | C13H17F3N4O2 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | [(9aR)-8-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol |
| SMILES | OC[C@]12COCCN1CCN(c1nccc(C(F)(F)F)n1)C2 |
| InChI | InChI=1S/C13H17F3N4O2/c14-13(15,16)10-1-2-17-11(18-10)19-3-4-20-5-6-22-9-12(20,7-19)8-21/h1-2,21H,3-9H2/t12-/m1/s1 |
| InChIKey | SASGAUVEQLYXNT-GFCCVEGCSA-N |
| XLogP | 0.38 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |