C16H19ClN4O2 — CID 139018490
[8-(6-chloroquinoxalin-2-yl)-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol (PubChem CID 139018490) has the molecular formula C16H19ClN4O2 and a molecular weight of 334.81 g/mol. Its IUPAC name is [8-(6-chloroquinoxalin-2-yl)-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol.
| Compound Name | [8-(6-chloroquinoxalin-2-yl)-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol |
|---|---|
| PubChem CID | 139018490 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | [8-(6-chloroquinoxalin-2-yl)-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol |
| SMILES | OCC12COCCN1CCN(c1cnc3cc(Cl)ccc3n1)C2 |
| InChI | InChI=1S/C16H19ClN4O2/c17-12-1-2-13-14(7-12)18-8-15(19-13)20-3-4-21-5-6-23-11-16(21,9-20)10-22/h1-2,7-8,22H,3-6,9-11H2 |
| InChIKey | BLEGQNUNJSIZOS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |