C25H24N6O3 — CID 151491691
bis(2-morpholin-4-ylquinoxalin-6-yl)methanone (PubChem CID 151491691) has the molecular formula C25H24N6O3 and a molecular weight of 456.51 g/mol. Its IUPAC name is bis(2-morpholin-4-ylquinoxalin-6-yl)methanone.
| Compound Name | bis(2-morpholin-4-ylquinoxalin-6-yl)methanone |
|---|---|
| PubChem CID | 151491691 |
| Molecular Formula | C25H24N6O3 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | bis(2-morpholin-4-ylquinoxalin-6-yl)methanone |
| SMILES | O=C(c1ccc2nc(N3CCOCC3)cnc2c1)c1ccc2nc(N3CCOCC3)cnc2c1 |
| InChI | InChI=1S/C25H24N6O3/c32-25(17-1-3-19-21(13-17)26-15-23(28-19)30-5-9-33-10-6-30)18-2-4-20-22(14-18)27-16-24(29-20)31-7-11-34-12-8-31/h1-4,13-16H,5-12H2 |
| InChIKey | POPCTPNVALRSGX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |