C19H16FN3O3 — CID 89478345
(2-fluoro-5-hydroxyphenyl)-(3-morpholin-4-ylquinoxalin-6-yl)methanone (PubChem CID 89478345) has the molecular formula C19H16FN3O3 and a molecular weight of 353.35 g/mol. Its IUPAC name is (2-fluoro-5-hydroxyphenyl)-(3-morpholin-4-ylquinoxalin-6-yl)methanone.
| Compound Name | (2-fluoro-5-hydroxyphenyl)-(3-morpholin-4-ylquinoxalin-6-yl)methanone |
|---|---|
| PubChem CID | 89478345 |
| Molecular Formula | C19H16FN3O3 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2-fluoro-5-hydroxyphenyl)-(3-morpholin-4-ylquinoxalin-6-yl)methanone |
| SMILES | O=C(c1ccc2ncc(N3CCOCC3)nc2c1)c1cc(O)ccc1F |
| InChI | InChI=1S/C19H16FN3O3/c20-15-3-2-13(24)10-14(15)19(25)12-1-4-16-17(9-12)22-18(11-21-16)23-5-7-26-8-6-23/h1-4,9-11,24H,5-8H2 |
| InChIKey | GJTUXBFHNAZYNI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |