C19H16ClN3O3 — CID 89478019
(2-chloro-3-hydroxyphenyl)-(3-morpholin-4-ylquinoxalin-6-yl)methanone (PubChem CID 89478019) has the molecular formula C19H16ClN3O3 and a molecular weight of 369.81 g/mol. Its IUPAC name is (2-chloro-3-hydroxyphenyl)-(3-morpholin-4-ylquinoxalin-6-yl)methanone.
| Compound Name | (2-chloro-3-hydroxyphenyl)-(3-morpholin-4-ylquinoxalin-6-yl)methanone |
|---|---|
| PubChem CID | 89478019 |
| Molecular Formula | C19H16ClN3O3 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | (2-chloro-3-hydroxyphenyl)-(3-morpholin-4-ylquinoxalin-6-yl)methanone |
| SMILES | O=C(c1ccc2ncc(N3CCOCC3)nc2c1)c1cccc(O)c1Cl |
| InChI | InChI=1S/C19H16ClN3O3/c20-18-13(2-1-3-16(18)24)19(25)12-4-5-14-15(10-12)22-17(11-21-14)23-6-8-26-9-7-23/h1-5,10-11,24H,6-9H2 |
| InChIKey | QHURPOOOVNRKAV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |