C14H21N5O3 — CID 87799262
4-(5-ethylpyrimidin-2-yl)-2-(methylamino)-2-(2-oxoethyl)piperazine-1-carboxylic acid (PubChem CID 87799262) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-(5-ethylpyrimidin-2-yl)-2-(methylamino)-2-(2-oxoethyl)piperazine-1-carboxylic acid.
| Compound Name | 4-(5-ethylpyrimidin-2-yl)-2-(methylamino)-2-(2-oxoethyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87799262 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 4-(5-ethylpyrimidin-2-yl)-2-(methylamino)-2-(2-oxoethyl)piperazine-1-carboxylic acid |
| SMILES | CCc1cnc(N2CCN(C(=O)O)C(CC=O)(NC)C2)nc1 |
| InChI | InChI=1S/C14H21N5O3/c1-3-11-8-16-12(17-9-11)18-5-6-19(13(21)22)14(10-18,15-2)4-7-20/h7-9,15H,3-6,10H2,1-2H3,(H,21,22) |
| InChIKey | FJTIOYOXLOQBDM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|