C14H18FN3O3 — CID 87798702
4-(4-fluorophenyl)-2-(methylamino)-2-(2-oxoethyl)piperazine-1-carboxylic acid (PubChem CID 87798702) has the molecular formula C14H18FN3O3 and a molecular weight of 295.31 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-(methylamino)-2-(2-oxoethyl)piperazine-1-carboxylic acid.
| Compound Name | 4-(4-fluorophenyl)-2-(methylamino)-2-(2-oxoethyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87798702 |
| Molecular Formula | C14H18FN3O3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 4-(4-fluorophenyl)-2-(methylamino)-2-(2-oxoethyl)piperazine-1-carboxylic acid |
| SMILES | CNC1(CC=O)CN(c2ccc(F)cc2)CCN1C(=O)O |
| InChI | InChI=1S/C14H18FN3O3/c1-16-14(6-9-19)10-17(7-8-18(14)13(20)21)12-4-2-11(15)3-5-12/h2-5,9,16H,6-8,10H2,1H3,(H,20,21) |
| InChIKey | HCLCNWAKGNDYDL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|