C14H18FN3O4 — CID 87818028
(2R)-2-[4-(4-fluorophenyl)piperazin-1-yl]-N,2-dihydroxy-4-oxobutanamide (PubChem CID 87818028) has the molecular formula C14H18FN3O4 and a molecular weight of 311.31 g/mol. Its IUPAC name is (2R)-2-[4-(4-fluorophenyl)piperazin-1-yl]-N,2-dihydroxy-4-oxobutanamide.
| Compound Name | (2R)-2-[4-(4-fluorophenyl)piperazin-1-yl]-N,2-dihydroxy-4-oxobutanamide |
|---|---|
| PubChem CID | 87818028 |
| Molecular Formula | C14H18FN3O4 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (2R)-2-[4-(4-fluorophenyl)piperazin-1-yl]-N,2-dihydroxy-4-oxobutanamide |
| SMILES | O=CC[C@@](O)(C(=O)NO)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H18FN3O4/c15-11-1-3-12(4-2-11)17-6-8-18(9-7-17)14(21,5-10-19)13(20)16-22/h1-4,10,21-22H,5-9H2,(H,16,20)/t14-/m1/s1 |
| InChIKey | SRSIJNLYGAVAKI-CQSZACIVSA-N |
| XLogP | -0.27 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|