C12H13F2NO2 — CID 115055627
3-fluoro-1-(4-fluorophenyl)piperidine-3-carboxylic acid (PubChem CID 115055627) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is 3-fluoro-1-(4-fluorophenyl)piperidine-3-carboxylic acid.
| Compound Name | 3-fluoro-1-(4-fluorophenyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 115055627 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-fluoro-1-(4-fluorophenyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1(F)CCCN(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C12H13F2NO2/c13-9-2-4-10(5-3-9)15-7-1-6-12(14,8-15)11(16)17/h2-5H,1,6-8H2,(H,16,17) |
| InChIKey | PXSJYPHQGFFSCX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |