C17H29N5O2 — CID 122128913
2-ethyl-2-[[[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methylamino]methyl]butanoic acid (PubChem CID 122128913) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-ethyl-2-[[[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methylamino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 122128913 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 2-ethyl-2-[[[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]methylamino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNCc1cnc(N2CCN(C)CC2)nc1)C(=O)O |
| InChI | InChI=1S/C17H29N5O2/c1-4-17(5-2,15(23)24)13-18-10-14-11-19-16(20-12-14)22-8-6-21(3)7-9-22/h11-12,18H,4-10,13H2,1-3H3,(H,23,24) |
| InChIKey | LTRLRTGNJSJTOL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |