C15H18N4S — CID 3005136
(E)-3-amino-N-benzyl-2-cyano-3-pyrrolidin-1-ylprop-2-enethioamide (PubChem CID 3005136) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is (E)-3-amino-N-benzyl-2-cyano-3-pyrrolidin-1-ylprop-2-enethioamide.
| Compound Name | (E)-3-amino-N-benzyl-2-cyano-3-pyrrolidin-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 3005136 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (E)-3-amino-N-benzyl-2-cyano-3-pyrrolidin-1-ylprop-2-enethioamide |
| SMILES | N#C/C(C(=S)NCc1ccccc1)=C(/N)N1CCCC1 |
| InChI | InChI=1S/C15H18N4S/c16-10-13(14(17)19-8-4-5-9-19)15(20)18-11-12-6-2-1-3-7-12/h1-3,6-7H,4-5,8-9,11,17H2,(H,18,20)/b14-13+ |
| InChIKey | NCSZDOLYFOWYJD-BUHFOSPRSA-N |
| XLogP | 1.89 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|