C9H20IN3O3 — CID 11964589
2-(ethoxycarbonylcarbamoylamino)ethyl-trimethylazanium iodide (PubChem CID 11964589) has the molecular formula C9H20IN3O3 and a molecular weight of 345.18 g/mol. Its IUPAC name is 2-(ethoxycarbonylcarbamoylamino)ethyl-trimethylazanium iodide.
| Compound Name | 2-(ethoxycarbonylcarbamoylamino)ethyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 11964589 |
| Molecular Formula | C9H20IN3O3 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2-(ethoxycarbonylcarbamoylamino)ethyl-trimethylazanium iodide |
| SMILES | CCOC(=O)NC(=O)NCC[N+](C)(C)C.[I-] |
| InChI | InChI=1S/C9H19N3O3.HI/c1-5-15-9(14)11-8(13)10-6-7-12(2,3)4;/h5-7H2,1-4H3,(H-,10,11,13,14);1H |
| InChIKey | ZULQFOZNDDRNSA-UHFFFAOYSA-N |
| XLogP | -2.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|