C15H22O7 — CID 71332704
triethyl 4-ethoxybuta-1,3-diene-1,2,3-tricarboxylate (PubChem CID 71332704) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is triethyl 4-ethoxybuta-1,3-diene-1,2,3-tricarboxylate.
| Compound Name | triethyl 4-ethoxybuta-1,3-diene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 71332704 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | triethyl 4-ethoxybuta-1,3-diene-1,2,3-tricarboxylate |
| SMILES | CCOC=C(C(=O)OCC)C(=CC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C15H22O7/c1-5-19-10-12(15(18)22-8-4)11(14(17)21-7-3)9-13(16)20-6-2/h9-10H,5-8H2,1-4H3 |
| InChIKey | YOTPQRXHXBJTAV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|