ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate

C12H17NO3S — CID 55003743

IUPACethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate
SMILESCCOC(=O)CN(C)C(=O)CCc1cccs1
InChIInChI=1S/C12H17NO3S/c1-3-16-12(15)9-13(2)11(14)7-6-10-5-4-8-17-10/h4-5,8H,3,6-7,9H2,1-2H3
InChIKeyIDUZVXAHYXQSQO-UHFFFAOYSA-N
MW255.34 g/mol
LogP1.70
Rot. Bonds6

About ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate

ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate (PubChem CID 55003743) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate.

Molecular Properties

Compound Nameethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate
PubChem CID55003743
Molecular FormulaC12H17NO3S
Molecular Weight255.34 g/mol
Exact Mass255.09
IUPAC Nameethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate
SMILESCCOC(=O)CN(C)C(=O)CCc1cccs1
InChIInChI=1S/C12H17NO3S/c1-3-16-12(15)9-13(2)11(14)7-6-10-5-4-8-17-10/h4-5,8H,3,6-7,9H2,1-2H3
InChIKeyIDUZVXAHYXQSQO-UHFFFAOYSA-N
XLogP1.70
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.34
LogP ≤ 51.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate?
The IUPAC name of ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate (CID 55003743) is ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate.
What is the SMILES notation for ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate?
The canonical SMILES for ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate is CCOC(=O)CN(C)C(=O)CCc1cccs1.
What is the InChIKey of ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate?
The InChIKey is IDUZVXAHYXQSQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO3S/c1-3-16-12(15)9-13(2)11(14)7-6-10-5-4-8-17-10/h4-5,8H,3,6-7,9H2,1-2H3.
What are the key properties of ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate?
ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate has a molecular weight of 255.34 g/mol, XLogP of 1.70, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[methyl(3-thiophen-2-ylpropanoyl)amino]acetate is sourced from PubChem (CID 55003743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).