C11H19N3O3 — CID 103261820
ethyl 3-hydroxy-4-[(1-methylpyrazol-3-yl)methylamino]butanoate (PubChem CID 103261820) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is ethyl 3-hydroxy-4-[(1-methylpyrazol-3-yl)methylamino]butanoate.
| Compound Name | ethyl 3-hydroxy-4-[(1-methylpyrazol-3-yl)methylamino]butanoate |
|---|---|
| PubChem CID | 103261820 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | ethyl 3-hydroxy-4-[(1-methylpyrazol-3-yl)methylamino]butanoate |
| SMILES | CCOC(=O)CC(O)CNCc1ccn(C)n1 |
| InChI | InChI=1S/C11H19N3O3/c1-3-17-11(16)6-10(15)8-12-7-9-4-5-14(2)13-9/h4-5,10,12,15H,3,6-8H2,1-2H3 |
| InChIKey | FYKARRHQGJYFSJ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |