C8H13N3O2 — CID 106104698
2-[2-(1-methylpyrazol-3-yl)ethylamino]acetic acid (PubChem CID 106104698) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-[2-(1-methylpyrazol-3-yl)ethylamino]acetic acid.
| Compound Name | 2-[2-(1-methylpyrazol-3-yl)ethylamino]acetic acid |
|---|---|
| PubChem CID | 106104698 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-[2-(1-methylpyrazol-3-yl)ethylamino]acetic acid |
| SMILES | Cn1ccc(CCNCC(=O)O)n1 |
| InChI | InChI=1S/C8H13N3O2/c1-11-5-3-7(10-11)2-4-9-6-8(12)13/h3,5,9H,2,4,6H2,1H3,(H,12,13) |
| InChIKey | KTBYTICJQDSMIN-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|