C13H23N3O2 — CID 106104833
1-(cyclopropylmethoxy)-3-[2-(1-methylpyrazol-3-yl)ethylamino]propan-2-ol (PubChem CID 106104833) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 1-(cyclopropylmethoxy)-3-[2-(1-methylpyrazol-3-yl)ethylamino]propan-2-ol.
| Compound Name | 1-(cyclopropylmethoxy)-3-[2-(1-methylpyrazol-3-yl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 106104833 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-(cyclopropylmethoxy)-3-[2-(1-methylpyrazol-3-yl)ethylamino]propan-2-ol |
| SMILES | Cn1ccc(CCNCC(O)COCC2CC2)n1 |
| InChI | InChI=1S/C13H23N3O2/c1-16-7-5-12(15-16)4-6-14-8-13(17)10-18-9-11-2-3-11/h5,7,11,13-14,17H,2-4,6,8-10H2,1H3 |
| InChIKey | VSHLCGBDYJPGDX-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|