C10H19N3O2 — CID 106104206
2,2-dimethoxy-N-[2-(1-methylpyrazol-3-yl)ethyl]ethanamine (PubChem CID 106104206) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2,2-dimethoxy-N-[2-(1-methylpyrazol-3-yl)ethyl]ethanamine.
| Compound Name | 2,2-dimethoxy-N-[2-(1-methylpyrazol-3-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 106104206 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2,2-dimethoxy-N-[2-(1-methylpyrazol-3-yl)ethyl]ethanamine |
| SMILES | COC(CNCCc1ccn(C)n1)OC |
| InChI | InChI=1S/C10H19N3O2/c1-13-7-5-9(12-13)4-6-11-8-10(14-2)15-3/h5,7,10-11H,4,6,8H2,1-3H3 |
| InChIKey | KOIJKBCBEIVGOC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|