C14H17F2N3O — CID 106104708
1-(2,6-difluorophenyl)-2-[2-(1-methylpyrazol-3-yl)ethylamino]ethanol (PubChem CID 106104708) has the molecular formula C14H17F2N3O and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-[2-(1-methylpyrazol-3-yl)ethylamino]ethanol.
| Compound Name | 1-(2,6-difluorophenyl)-2-[2-(1-methylpyrazol-3-yl)ethylamino]ethanol |
|---|---|
| PubChem CID | 106104708 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-[2-(1-methylpyrazol-3-yl)ethylamino]ethanol |
| SMILES | Cn1ccc(CCNCC(O)c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C14H17F2N3O/c1-19-8-6-10(18-19)5-7-17-9-13(20)14-11(15)3-2-4-12(14)16/h2-4,6,8,13,17,20H,5,7,9H2,1H3 |
| InChIKey | BGIWESUAZBBQMM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|