C13H19BrF2N2O — CID 43220482
N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 43220482) has the molecular formula C13H19BrF2N2O and a molecular weight of 337.21 g/mol. Its IUPAC name is N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 43220482 |
| Molecular Formula | C13H19BrF2N2O |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCc1cc(Br)ccc1OC(F)F |
| InChI | InChI=1S/C13H19BrF2N2O/c1-18(2)7-3-6-17-9-10-8-11(14)4-5-12(10)19-13(15)16/h4-5,8,13,17H,3,6-7,9H2,1-2H3 |
| InChIKey | MCEMVLXUQQATAT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|