C18H19FN4O — CID 95325998
(6S)-N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95325998) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is (6S)-N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95325998 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (6S)-N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Cc1nc2n(n1)C[C@@H](NCc1ccc(-c3ccc(F)cc3)o1)CC2 |
| InChI | InChI=1S/C18H19FN4O/c1-12-21-18-9-6-15(11-23(18)22-12)20-10-16-7-8-17(24-16)13-2-4-14(19)5-3-13/h2-5,7-8,15,20H,6,9-11H2,1H3/t15-/m0/s1 |
| InChIKey | VENVRJRNNYHXCE-HNNXBMFYSA-N |
| XLogP | 3.09 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |