C19H19ClN6O — CID 136517247
2-(4-chlorophenyl)-6-methyl-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)pyrimidine-4-carboxamide (PubChem CID 136517247) has the molecular formula C19H19ClN6O and a molecular weight of 382.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-methyl-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)pyrimidine-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-6-methyl-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 136517247 |
| Molecular Formula | C19H19ClN6O |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-(4-chlorophenyl)-6-methyl-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCc3nc(C)nn3C2)nc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H19ClN6O/c1-11-9-16(24-18(21-11)13-3-5-14(20)6-4-13)19(27)23-15-7-8-17-22-12(2)25-26(17)10-15/h3-6,9,15H,7-8,10H2,1-2H3,(H,23,27) |
| InChIKey | KEZJFIKOGQAAER-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |