C17H22ClF2IN6O — CID 111995222
1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide (PubChem CID 111995222) has the molecular formula C17H22ClF2IN6O and a molecular weight of 526.76 g/mol. Its IUPAC name is 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide.
| Compound Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111995222 |
| Molecular Formula | C17H22ClF2IN6O |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | 1-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(Cl)ccc1OC(F)F)NC1CCc2nc(C)nn2C1.I |
| InChI | InChI=1S/C17H21ClF2N6O.HI/c1-10-23-15-6-4-13(9-26(15)25-10)24-17(21-2)22-8-11-7-12(18)3-5-14(11)27-16(19)20;/h3,5,7,13,16H,4,6,8-9H2,1-2H3,(H2,21,22,24);1H |
| InChIKey | YKQZMZSZHHVXEU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|