C12H20F3IN6O — CID 119153970
2-methyl-1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide (PubChem CID 119153970) has the molecular formula C12H20F3IN6O and a molecular weight of 448.23 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119153970 |
| Molecular Formula | C12H20F3IN6O |
| Molecular Weight | 448.23 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 2-methyl-1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(O)C(F)(F)F)NC1CCc2nc(C)nn2C1.I |
| InChI | InChI=1S/C12H19F3N6O.HI/c1-7-18-10-4-3-8(6-21(10)20-7)19-11(16-2)17-5-9(22)12(13,14)15;/h8-9,22H,3-6H2,1-2H3,(H2,16,17,19);1H |
| InChIKey | UNBXFPQFVYLHFL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|